C27H21F3IN3O4 — CID 126113486
N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126113486) has the molecular formula C27H21F3IN3O4 and a molecular weight of 635.38 g/mol. Its IUPAC name is N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126113486 |
| Molecular Formula | C27H21F3IN3O4 |
| Molecular Weight | 635.38 g/mol |
| Exact Mass | 635.05 |
| IUPAC Name | N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | CCOc1cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C27H21F3IN3O4/c1-2-37-25-13-17(15-32-33-23-11-10-20(27(28,29)30)14-24(23)34(35)36)12-22(31)26(25)38-16-19-8-5-7-18-6-3-4-9-21(18)19/h3-15,33H,2,16H2,1H3/b32-15- |
| InChIKey | VJEDEBMVIZNGHM-CNCDYAKUSA-N |
| XLogP | 7.80 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.38 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|