C21H13BrF3I2N3O3 — CID 126095239
N-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126095239) has the molecular formula C21H13BrF3I2N3O3 and a molecular weight of 746.06 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126095239 |
| Molecular Formula | C21H13BrF3I2N3O3 |
| Molecular Weight | 746.06 g/mol |
| Exact Mass | 744.82 |
| IUPAC Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N/N=C\c1cc(I)c(OCc2ccc(Br)cc2)c(I)c1 |
| InChI | InChI=1S/C21H13BrF3I2N3O3/c22-15-4-1-12(2-5-15)11-33-20-16(26)7-13(8-17(20)27)10-28-29-18-6-3-14(21(23,24)25)9-19(18)30(31)32/h1-10,29H,11H2/b28-10- |
| InChIKey | LZNLDZQVZHSDPV-LGUSAWBASA-N |
| XLogP | 7.61 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.06 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|