C20H13I2N5O7 — CID 21370918
N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 21370918) has the molecular formula C20H13I2N5O7 and a molecular weight of 689.16 g/mol. Its IUPAC name is N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 21370918 |
| Molecular Formula | C20H13I2N5O7 |
| Molecular Weight | 689.16 g/mol |
| Exact Mass | 688.89 |
| IUPAC Name | N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(COc2c(I)cc(/C=N/Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2I)cc1 |
| InChI | InChI=1S/C20H13I2N5O7/c21-16-7-13(10-23-24-18-6-5-15(26(30)31)9-19(18)27(32)33)8-17(22)20(16)34-11-12-1-3-14(4-2-12)25(28)29/h1-10,24H,11H2/b23-10+ |
| InChIKey | XSTQRIOOFVKRGZ-AUEPDCJTSA-N |
| XLogP | 5.65 |
| TPSA | 163.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.16 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|