C23H18F4IN3O4 — CID 126099255
N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126099255) has the molecular formula C23H18F4IN3O4 and a molecular weight of 603.31 g/mol. Its IUPAC name is N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126099255 |
| Molecular Formula | C23H18F4IN3O4 |
| Molecular Weight | 603.31 g/mol |
| Exact Mass | 603.03 |
| IUPAC Name | N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | CCOc1cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc(I)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H18F4IN3O4/c1-2-34-21-10-15(9-18(28)22(21)35-13-14-3-6-17(24)7-4-14)12-29-30-19-8-5-16(23(25,26)27)11-20(19)31(32)33/h3-12,30H,2,13H2,1H3/b29-12- |
| InChIKey | XSLPCRZEWCOOMQ-ULPWCQAASA-N |
| XLogP | 6.78 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.31 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|