C22H15Cl2F3IN3O4 — CID 126107077
N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126107077) has the molecular formula C22H15Cl2F3IN3O4 and a molecular weight of 640.18 g/mol. Its IUPAC name is N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126107077 |
| Molecular Formula | C22H15Cl2F3IN3O4 |
| Molecular Weight | 640.18 g/mol |
| Exact Mass | 638.94 |
| IUPAC Name | N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | COc1cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc(I)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H15Cl2F3IN3O4/c1-34-20-8-13(7-17(28)21(20)35-11-12-2-4-15(23)16(24)6-12)10-29-30-18-5-3-14(22(25,26)27)9-19(18)31(32)33/h2-10,30H,11H2,1H3/b29-10- |
| InChIKey | RXMMSLDWHJHLNE-DANHRZQXSA-N |
| XLogP | 7.56 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.18 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|