C19H17F3IN3O4 — CID 126072954
N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126072954) has the molecular formula C19H17F3IN3O4 and a molecular weight of 535.26 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126072954 |
| Molecular Formula | C19H17F3IN3O4 |
| Molecular Weight | 535.26 g/mol |
| Exact Mass | 535.02 |
| IUPAC Name | N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | C=CCOc1c(I)cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C19H17F3IN3O4/c1-3-7-30-18-14(23)8-12(9-17(18)29-4-2)11-24-25-15-6-5-13(19(20,21)22)10-16(15)26(27)28/h3,5-6,8-11,25H,1,4,7H2,2H3/b24-11- |
| InChIKey | BYHXHNBNPBNWRL-MYKKPKGFSA-N |
| XLogP | 5.63 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|