C24H21F3IN3O4 — CID 126112950
N-[(Z)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126112950) has the molecular formula C24H21F3IN3O4 and a molecular weight of 599.35 g/mol. Its IUPAC name is N-[(Z)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126112950 |
| Molecular Formula | C24H21F3IN3O4 |
| Molecular Weight | 599.35 g/mol |
| Exact Mass | 599.05 |
| IUPAC Name | N-[(Z)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | CCOc1cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc(I)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H21F3IN3O4/c1-3-34-22-11-17(10-19(28)23(22)35-14-16-6-4-15(2)5-7-16)13-29-30-20-9-8-18(24(25,26)27)12-21(20)31(32)33/h4-13,30H,3,14H2,1-2H3/b29-13- |
| InChIKey | OHPRMXLFPYFBKA-DBFSUHOCSA-N |
| XLogP | 6.95 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.35 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|