C22H16Br2F3N3O4 — CID 126112982
N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126112982) has the molecular formula C22H16Br2F3N3O4 and a molecular weight of 603.19 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126112982 |
| Molecular Formula | C22H16Br2F3N3O4 |
| Molecular Weight | 603.19 g/mol |
| Exact Mass | 600.95 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | COc1cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H16Br2F3N3O4/c1-33-20-9-14(8-17(24)21(20)34-12-13-2-5-16(23)6-3-13)11-28-29-18-7-4-15(22(25,26)27)10-19(18)30(31)32/h2-11,29H,12H2,1H3/b28-11- |
| InChIKey | OMIRMYORLUWLDV-FXMZOFOKSA-N |
| XLogP | 7.17 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.19 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|