C25H21F3N4O6 — CID 126106008
N-[(Z)-[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126106008) has the molecular formula C25H21F3N4O6 and a molecular weight of 530.46 g/mol. Its IUPAC name is N-[(Z)-[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126106008 |
| Molecular Formula | C25H21F3N4O6 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | N-[(Z)-[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | C=CCc1cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc(OC)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H21F3N4O6/c1-3-4-18-11-17(14-29-30-21-10-7-19(25(26,27)28)13-22(21)32(35)36)12-23(37-2)24(18)38-15-16-5-8-20(9-6-16)31(33)34/h3,5-14,30H,1,4,15H2,2H3/b29-14- |
| InChIKey | RVASQKTXYAMQPA-NUJZUDFISA-N |
| XLogP | 6.28 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|