C20H12Cl2I2N4O5 — CID 21370915
N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 21370915) has the molecular formula C20H12Cl2I2N4O5 and a molecular weight of 713.05 g/mol. Its IUPAC name is N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 21370915 |
| Molecular Formula | C20H12Cl2I2N4O5 |
| Molecular Weight | 713.05 g/mol |
| Exact Mass | 711.83 |
| IUPAC Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2cc(I)c(OCc3ccc(Cl)cc3Cl)c(I)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H12Cl2I2N4O5/c21-13-2-1-12(15(22)7-13)10-33-20-16(23)5-11(6-17(20)24)9-25-26-18-4-3-14(27(29)30)8-19(18)28(31)32/h1-9,26H,10H2/b25-9+ |
| InChIKey | VOZTZUSMWMPHAR-YCPBAFNGSA-N |
| XLogP | 7.04 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.05 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|