C13H8Cl2N4O5 — CID 5173716
2,4-dichloro-6-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol (PubChem CID 5173716) has the molecular formula C13H8Cl2N4O5 and a molecular weight of 371.14 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 5173716 |
| Molecular Formula | C13H8Cl2N4O5 |
| Molecular Weight | 371.14 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 2,4-dichloro-6-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2cc(Cl)cc(Cl)c2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8Cl2N4O5/c14-8-3-7(13(20)10(15)4-8)6-16-17-11-2-1-9(18(21)22)5-12(11)19(23)24/h1-6,17,20H |
| InChIKey | VTUDBXVAACAAKF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.14 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|