C13H9BrN4O5 — CID 137122714
4-bromo-2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol (PubChem CID 137122714) has the molecular formula C13H9BrN4O5 and a molecular weight of 381.14 g/mol. Its IUPAC name is 4-bromo-2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 137122714 |
| Molecular Formula | C13H9BrN4O5 |
| Molecular Weight | 381.14 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 4-bromo-2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2cc(Br)ccc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9BrN4O5/c14-9-1-4-13(19)8(5-9)7-15-16-11-3-2-10(17(20)21)6-12(11)18(22)23/h1-7,16,19H/b15-7- |
| InChIKey | DOCJUQMGOWERPU-CHHVJCJISA-N |
| XLogP | 3.42 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|