C12H8BrN3O5 — CID 86702719
4-bromo-2-(2,4-dinitroanilino)phenol (PubChem CID 86702719) has the molecular formula C12H8BrN3O5 and a molecular weight of 354.12 g/mol. Its IUPAC name is 4-bromo-2-(2,4-dinitroanilino)phenol.
| Compound Name | 4-bromo-2-(2,4-dinitroanilino)phenol |
|---|---|
| PubChem CID | 86702719 |
| Molecular Formula | C12H8BrN3O5 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 352.96 |
| IUPAC Name | 4-bromo-2-(2,4-dinitroanilino)phenol |
| SMILES | O=[N+]([O-])c1ccc(Nc2cc(Br)ccc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H8BrN3O5/c13-7-1-4-12(17)10(5-7)14-9-3-2-8(15(18)19)6-11(9)16(20)21/h1-6,14,17H |
| InChIKey | OXDLYMIWMZQTHM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|