About azane;2,4-dinitrophenol;hydrate
azane;2,4-dinitrophenol;hydrate (PubChem CID 174664401) has the molecular formula C6H9N3O6
and a molecular weight of 219.15 g/mol. Its IUPAC name is azane;2,4-dinitrophenol;hydrate.
Molecular Properties
| Compound Name | azane;2,4-dinitrophenol;hydrate |
| PubChem CID | 174664401 |
| Molecular Formula | C6H9N3O6 |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | azane;2,4-dinitrophenol;hydrate |
| SMILES | N.O.O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N2O5.H3N.H2O/c9-6-2-1-4(7(10)11)3-5(6)8(12)13;;/h1-3,9H;1H3;1H2 |
| InChIKey | OAVZKWKCVODCKH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 173.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;2,4-dinitrophenol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,4-dinitrophenol;hydrate?
The IUPAC name of azane;2,4-dinitrophenol;hydrate (CID 174664401) is azane;2,4-dinitrophenol;hydrate.
What is the SMILES notation for azane;2,4-dinitrophenol;hydrate?
The canonical SMILES for azane;2,4-dinitrophenol;hydrate is N.O.O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1.
What is the InChIKey of azane;2,4-dinitrophenol;hydrate?
The InChIKey is OAVZKWKCVODCKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O5.H3N.H2O/c9-6-2-1-4(7(10)11)3-5(6)8(12)13;;/h1-3,9H;1H3;1H2.
What are the key properties of azane;2,4-dinitrophenol;hydrate?
azane;2,4-dinitrophenol;hydrate has a molecular weight of 219.15 g/mol, XLogP of 0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,4-dinitrophenol;hydrate is sourced from PubChem (CID 174664401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).