C14H12N4O12 — CID 88801874
acetic acid;bis(2,4-dinitrophenol) (PubChem CID 88801874) has the molecular formula C14H12N4O12 and a molecular weight of 428.27 g/mol. Its IUPAC name is acetic acid;bis(2,4-dinitrophenol).
| Compound Name | acetic acid;bis(2,4-dinitrophenol) |
|---|---|
| PubChem CID | 88801874 |
| Molecular Formula | C14H12N4O12 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | acetic acid;bis(2,4-dinitrophenol) |
| SMILES | CC(=O)O.O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/2C6H4N2O5.C2H4O2/c2*9-6-2-1-4(7(10)11)3-5(6)8(12)13;1-2(3)4/h2*1-3,9H;1H3,(H,3,4) |
| InChIKey | JDVDOAVYODBTFG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 250.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|