About 2-nitro-4-phenylphenol
2-nitro-4-phenylphenol (PubChem CID 13447) has the molecular formula C12H9NO3
and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-nitro-4-phenylphenol.
Molecular Properties
| Compound Name | 2-nitro-4-phenylphenol |
| PubChem CID | 13447 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-nitro-4-phenylphenol |
| SMILES | O=[N+]([O-])c1cc(-c2ccccc2)ccc1O |
| InChI | InChI=1S/C12H9NO3/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,14H |
| InChIKey | JDDNJJBXFOLPKX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-4-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-4-phenylphenol?
The IUPAC name of 2-nitro-4-phenylphenol (CID 13447) is 2-nitro-4-phenylphenol.
What is the SMILES notation for 2-nitro-4-phenylphenol?
The canonical SMILES for 2-nitro-4-phenylphenol is O=[N+]([O-])c1cc(-c2ccccc2)ccc1O.
What is the InChIKey of 2-nitro-4-phenylphenol?
The InChIKey is JDDNJJBXFOLPKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,14H.
What are the key properties of 2-nitro-4-phenylphenol?
2-nitro-4-phenylphenol has a molecular weight of 215.21 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-4-phenylphenol is sourced from PubChem (CID 13447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).