About ethane;2-nitro-4-phenylphenol
ethane;2-nitro-4-phenylphenol (PubChem CID 142062484) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is ethane;2-nitro-4-phenylphenol.
Molecular Properties
| Compound Name | ethane;2-nitro-4-phenylphenol |
| PubChem CID | 142062484 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | ethane;2-nitro-4-phenylphenol |
| SMILES | CC.O=[N+]([O-])c1cc(-c2ccccc2)ccc1O |
| InChI | InChI=1S/C12H9NO3.C2H6/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9;1-2/h1-8,14H;1-2H3 |
| InChIKey | YSNLFJFBNFGGHV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-nitro-4-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-nitro-4-phenylphenol?
The IUPAC name of ethane;2-nitro-4-phenylphenol (CID 142062484) is ethane;2-nitro-4-phenylphenol.
What is the SMILES notation for ethane;2-nitro-4-phenylphenol?
The canonical SMILES for ethane;2-nitro-4-phenylphenol is CC.O=[N+]([O-])c1cc(-c2ccccc2)ccc1O.
What is the InChIKey of ethane;2-nitro-4-phenylphenol?
The InChIKey is YSNLFJFBNFGGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3.C2H6/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9;1-2/h1-8,14H;1-2H3.
What are the key properties of ethane;2-nitro-4-phenylphenol?
ethane;2-nitro-4-phenylphenol has a molecular weight of 245.28 g/mol, XLogP of 3.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-nitro-4-phenylphenol is sourced from PubChem (CID 142062484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).