About 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium
2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium (PubChem CID 139064927) has the molecular formula C12H11N3O7
and a molecular weight of 309.23 g/mol. Its IUPAC name is 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium.
Molecular Properties
| Compound Name | 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium |
| PubChem CID | 139064927 |
| Molecular Formula | C12H11N3O7 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium |
| SMILES | COc1cc[n+]([O-])cc1.O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N2O5.C6H7NO2/c9-6-2-1-4(7(10)11)3-5(6)8(12)13;1-9-6-2-4-7(8)5-3-6/h1-3,9H;2-5H,1H3 |
| InChIKey | TVKWUXATNZUZHH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium?
The IUPAC name of 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium (CID 139064927) is 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium.
What is the SMILES notation for 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium?
The canonical SMILES for 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium is COc1cc[n+]([O-])cc1.O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1.
What is the InChIKey of 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium?
The InChIKey is TVKWUXATNZUZHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O5.C6H7NO2/c9-6-2-1-4(7(10)11)3-5(6)8(12)13;1-9-6-2-4-7(8)5-3-6/h1-3,9H;2-5H,1H3.
What are the key properties of 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium?
2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium has a molecular weight of 309.23 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dinitrophenol;4-methoxy-1-oxidopyridin-1-ium is sourced from PubChem (CID 139064927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).