About ethane;5-methoxy-2-nitrophenol
ethane;5-methoxy-2-nitrophenol (PubChem CID 143133372) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is ethane;5-methoxy-2-nitrophenol.
Molecular Properties
| Compound Name | ethane;5-methoxy-2-nitrophenol |
| PubChem CID | 143133372 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | ethane;5-methoxy-2-nitrophenol |
| SMILES | CC.COc1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C7H7NO4.C2H6/c1-12-5-2-3-6(8(10)11)7(9)4-5;1-2/h2-4,9H,1H3;1-2H3 |
| InChIKey | FSMAPEJYEFCZLZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methoxy-2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methoxy-2-nitrophenol?
The IUPAC name of ethane;5-methoxy-2-nitrophenol (CID 143133372) is ethane;5-methoxy-2-nitrophenol.
What is the SMILES notation for ethane;5-methoxy-2-nitrophenol?
The canonical SMILES for ethane;5-methoxy-2-nitrophenol is CC.COc1ccc([N+](=O)[O-])c(O)c1.
What is the InChIKey of ethane;5-methoxy-2-nitrophenol?
The InChIKey is FSMAPEJYEFCZLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4.C2H6/c1-12-5-2-3-6(8(10)11)7(9)4-5;1-2/h2-4,9H,1H3;1-2H3.
What are the key properties of ethane;5-methoxy-2-nitrophenol?
ethane;5-methoxy-2-nitrophenol has a molecular weight of 199.21 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methoxy-2-nitrophenol is sourced from PubChem (CID 143133372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).