About 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol
2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol (PubChem CID 159971508) has the molecular formula C14H12Br2N2O8
and a molecular weight of 496.06 g/mol. Its IUPAC name is 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol.
Molecular Properties
| Compound Name | 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol |
| PubChem CID | 159971508 |
| Molecular Formula | C14H12Br2N2O8 |
| Molecular Weight | 496.06 g/mol |
| Exact Mass | 493.90 |
| IUPAC Name | 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol |
| SMILES | COc1c(Br)cc([N+](=O)[O-])c(O)c1Br.COc1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C7H5Br2NO4.C7H7NO4/c1-14-7-3(8)2-4(10(12)13)6(11)5(7)9;1-12-5-2-3-6(8(10)11)7(9)4-5/h2,11H,1H3;2-4,9H,1H3 |
| InChIKey | OEPJUZHAQFMQMC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.06 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol?
The IUPAC name of 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol (CID 159971508) is 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol.
What is the SMILES notation for 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol?
The canonical SMILES for 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol is COc1c(Br)cc([N+](=O)[O-])c(O)c1Br.COc1ccc([N+](=O)[O-])c(O)c1.
What is the InChIKey of 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol?
The InChIKey is OEPJUZHAQFMQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Br2NO4.C7H7NO4/c1-14-7-3(8)2-4(10(12)13)6(11)5(7)9;1-12-5-2-3-6(8(10)11)7(9)4-5/h2,11H,1H3;2-4,9H,1H3.
What are the key properties of 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol?
2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol has a molecular weight of 496.06 g/mol, XLogP of 4.14, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-3-methoxy-6-nitrophenol;5-methoxy-2-nitrophenol is sourced from PubChem (CID 159971508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).