C6H3BrN2O6 — CID 18958398
2-bromo-4,6-dinitrobenzene-1,3-diol (PubChem CID 18958398) has the molecular formula C6H3BrN2O6 and a molecular weight of 279.00 g/mol. Its IUPAC name is 2-bromo-4,6-dinitrobenzene-1,3-diol.
| Compound Name | 2-bromo-4,6-dinitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 18958398 |
| Molecular Formula | C6H3BrN2O6 |
| Molecular Weight | 279.00 g/mol |
| Exact Mass | 277.92 |
| IUPAC Name | 2-bromo-4,6-dinitrobenzene-1,3-diol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c(Br)c1O |
| InChI | InChI=1S/C6H3BrN2O6/c7-4-5(10)2(8(12)13)1-3(6(4)11)9(14)15/h1,10-11H |
| InChIKey | UZZWPKWRHVNQHU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.00 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|