C6H5N3O8Pb — CID 173370701
λ2-plumbane;2,4,6-trinitrobenzene-1,3-diol (PubChem CID 173370701) has the molecular formula C6H5N3O8Pb and a molecular weight of 454.32 g/mol. Its IUPAC name is λ2-plumbane;2,4,6-trinitrobenzene-1,3-diol.
| Compound Name | λ2-plumbane;2,4,6-trinitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 173370701 |
| Molecular Formula | C6H5N3O8Pb |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | λ2-plumbane;2,4,6-trinitrobenzene-1,3-diol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1O.[PbH2] |
| InChI | InChI=1S/C6H3N3O8.Pb.2H/c10-5-2(7(12)13)1-3(8(14)15)6(11)4(5)9(16)17;;;/h1,10-11H;;; |
| InChIKey | FHDZWCZABNLCNX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|