C12H4N6O13 — CID 14927164
2,4,6-trinitro-3-(2,4,6-trinitrophenyl)phenol (PubChem CID 14927164) has the molecular formula C12H4N6O13 and a molecular weight of 440.19 g/mol. Its IUPAC name is 2,4,6-trinitro-3-(2,4,6-trinitrophenyl)phenol.
| Compound Name | 2,4,6-trinitro-3-(2,4,6-trinitrophenyl)phenol |
|---|---|
| PubChem CID | 14927164 |
| Molecular Formula | C12H4N6O13 |
| Molecular Weight | 440.19 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 2,4,6-trinitro-3-(2,4,6-trinitrophenyl)phenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(-c2c([N+](=O)[O-])cc([N+](=O)[O-])c(O)c2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H4N6O13/c19-12-8(17(28)29)3-7(16(26)27)10(11(12)18(30)31)9-5(14(22)23)1-4(13(20)21)2-6(9)15(24)25/h1-3,19H |
| InChIKey | LSYTUIXMGBCHQG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 279.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|