C12H6N4O9 — CID 22345898
2,4,6-trinitro-3-(2-nitrophenyl)phenol (PubChem CID 22345898) has the molecular formula C12H6N4O9 and a molecular weight of 350.20 g/mol. Its IUPAC name is 2,4,6-trinitro-3-(2-nitrophenyl)phenol.
| Compound Name | 2,4,6-trinitro-3-(2-nitrophenyl)phenol |
|---|---|
| PubChem CID | 22345898 |
| Molecular Formula | C12H6N4O9 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 2,4,6-trinitro-3-(2-nitrophenyl)phenol |
| SMILES | O=[N+]([O-])c1ccccc1-c1c([N+](=O)[O-])cc([N+](=O)[O-])c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H6N4O9/c17-12-9(15(22)23)5-8(14(20)21)10(11(12)16(24)25)6-3-1-2-4-7(6)13(18)19/h1-5,17H |
| InChIKey | OCCIVEAUDNQWHZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 192.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|