C20H12N2O6 — CID 174782436
anthracene-9,10-dione;1,2-dinitrobenzene (PubChem CID 174782436) has the molecular formula C20H12N2O6 and a molecular weight of 376.32 g/mol. Its IUPAC name is anthracene-9,10-dione;1,2-dinitrobenzene.
| Compound Name | anthracene-9,10-dione;1,2-dinitrobenzene |
|---|---|
| PubChem CID | 174782436 |
| Molecular Formula | C20H12N2O6 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | anthracene-9,10-dione;1,2-dinitrobenzene |
| SMILES | O=C1c2ccccc2C(=O)c2ccccc21.O=[N+]([O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8O2.C6H4N2O4/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-8H;1-4H |
| InChIKey | QITAACZISUQSBL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|