About azanide;1,2-dinitrobenzene;platinum
azanide;1,2-dinitrobenzene;platinum (PubChem CID 158959684) has the molecular formula C6H6N3O4Pt-
and a molecular weight of 379.21 g/mol. Its IUPAC name is azanide;1,2-dinitrobenzene;platinum.
Molecular Properties
| Compound Name | azanide;1,2-dinitrobenzene;platinum |
| PubChem CID | 158959684 |
| Molecular Formula | C6H6N3O4Pt- |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | azanide;1,2-dinitrobenzene;platinum |
| SMILES | O=[N+]([O-])c1ccccc1[N+](=O)[O-].[NH2-].[Pt] |
| InChI | InChI=1S/C6H4N2O4.H2N.Pt/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H;1H2;/q;-1; |
| InChIKey | RWNVFIYSPVELQQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 119.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanide;1,2-dinitrobenzene;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;1,2-dinitrobenzene;platinum?
The IUPAC name of azanide;1,2-dinitrobenzene;platinum (CID 158959684) is azanide;1,2-dinitrobenzene;platinum.
What is the SMILES notation for azanide;1,2-dinitrobenzene;platinum?
The canonical SMILES for azanide;1,2-dinitrobenzene;platinum is O=[N+]([O-])c1ccccc1[N+](=O)[O-].[NH2-].[Pt].
What is the InChIKey of azanide;1,2-dinitrobenzene;platinum?
The InChIKey is RWNVFIYSPVELQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O4.H2N.Pt/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H;1H2;/q;-1;.
What are the key properties of azanide;1,2-dinitrobenzene;platinum?
azanide;1,2-dinitrobenzene;platinum has a molecular weight of 379.21 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;1,2-dinitrobenzene;platinum is sourced from PubChem (CID 158959684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).