About 2-nitroaniline;sulfane
2-nitroaniline;sulfane (PubChem CID 175331446) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-nitroaniline;sulfane.
Molecular Properties
| Compound Name | 2-nitroaniline;sulfane |
| PubChem CID | 175331446 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2-nitroaniline;sulfane |
| SMILES | Nc1ccccc1[N+](=O)[O-].S |
| InChI | InChI=1S/C6H6N2O2.H2S/c7-5-3-1-2-4-6(5)8(9)10;/h1-4H,7H2;1H2 |
| InChIKey | ZMNOZAVXIDVULO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroaniline;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroaniline;sulfane?
The IUPAC name of 2-nitroaniline;sulfane (CID 175331446) is 2-nitroaniline;sulfane.
What is the SMILES notation for 2-nitroaniline;sulfane?
The canonical SMILES for 2-nitroaniline;sulfane is Nc1ccccc1[N+](=O)[O-].S.
What is the InChIKey of 2-nitroaniline;sulfane?
The InChIKey is ZMNOZAVXIDVULO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.H2S/c7-5-3-1-2-4-6(5)8(9)10;/h1-4H,7H2;1H2.
What are the key properties of 2-nitroaniline;sulfane?
2-nitroaniline;sulfane has a molecular weight of 172.21 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroaniline;sulfane is sourced from PubChem (CID 175331446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).