C12H12N4O6 — CID 161330338
2,6-diaminophenol;2,6-dinitrophenol (PubChem CID 161330338) has the molecular formula C12H12N4O6 and a molecular weight of 308.25 g/mol. Its IUPAC name is 2,6-diaminophenol;2,6-dinitrophenol.
| Compound Name | 2,6-diaminophenol;2,6-dinitrophenol |
|---|---|
| PubChem CID | 161330338 |
| Molecular Formula | C12H12N4O6 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2,6-diaminophenol;2,6-dinitrophenol |
| SMILES | Nc1cccc(N)c1O.O=[N+]([O-])c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C6H4N2O5.C6H8N2O/c9-6-4(7(10)11)2-1-3-5(6)8(12)13;7-4-2-1-3-5(8)6(4)9/h1-3,9H;1-3,9H,7-8H2 |
| InChIKey | VLIGZBYZKKNKEG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|