C16H14N4O6 — CID 173446234
2-[2,3-diamino-4-(2-hydroxy-3-nitrophenyl)buta-1,3-dienyl]-6-nitrophenol (PubChem CID 173446234) has the molecular formula C16H14N4O6 and a molecular weight of 358.31 g/mol. Its IUPAC name is 2-[2,3-diamino-4-(2-hydroxy-3-nitrophenyl)buta-1,3-dienyl]-6-nitrophenol.
| Compound Name | 2-[2,3-diamino-4-(2-hydroxy-3-nitrophenyl)buta-1,3-dienyl]-6-nitrophenol |
|---|---|
| PubChem CID | 173446234 |
| Molecular Formula | C16H14N4O6 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[2,3-diamino-4-(2-hydroxy-3-nitrophenyl)buta-1,3-dienyl]-6-nitrophenol |
| SMILES | NC(=Cc1cccc([N+](=O)[O-])c1O)C(N)=Cc1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H14N4O6/c17-11(7-9-3-1-5-13(15(9)21)19(23)24)12(18)8-10-4-2-6-14(16(10)22)20(25)26/h1-8,21-22H,17-18H2 |
| InChIKey | SWPOBUJLGQIGAV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|