About acetylene;2-nitroaniline
acetylene;2-nitroaniline (PubChem CID 142135116) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is acetylene;2-nitroaniline.
Molecular Properties
| Compound Name | acetylene;2-nitroaniline |
| PubChem CID | 142135116 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | acetylene;2-nitroaniline |
| SMILES | C#C.Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N2O2.C2H2/c7-5-3-1-2-4-6(5)8(9)10;1-2/h1-4H,7H2;1-2H |
| InChIKey | QDUSJHDCDCJNRT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2-nitroaniline?
The IUPAC name of acetylene;2-nitroaniline (CID 142135116) is acetylene;2-nitroaniline.
What is the SMILES notation for acetylene;2-nitroaniline?
The canonical SMILES for acetylene;2-nitroaniline is C#C.Nc1ccccc1[N+](=O)[O-].
What is the InChIKey of acetylene;2-nitroaniline?
The InChIKey is QDUSJHDCDCJNRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.C2H2/c7-5-3-1-2-4-6(5)8(9)10;1-2/h1-4H,7H2;1-2H.
What are the key properties of acetylene;2-nitroaniline?
acetylene;2-nitroaniline has a molecular weight of 164.16 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2-nitroaniline is sourced from PubChem (CID 142135116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).