About 2-nitroaniline;propanoic acid
2-nitroaniline;propanoic acid (PubChem CID 175475481) has the molecular formula C12H18N2O6
and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-nitroaniline;propanoic acid.
Molecular Properties
| Compound Name | 2-nitroaniline;propanoic acid |
| PubChem CID | 175475481 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-nitroaniline;propanoic acid |
| SMILES | CCC(=O)O.CCC(=O)O.Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N2O2.2C3H6O2/c7-5-3-1-2-4-6(5)8(9)10;2*1-2-3(4)5/h1-4H,7H2;2*2H2,1H3,(H,4,5) |
| InChIKey | BOKSFHHVDHNYLN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroaniline;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroaniline;propanoic acid?
The IUPAC name of 2-nitroaniline;propanoic acid (CID 175475481) is 2-nitroaniline;propanoic acid.
What is the SMILES notation for 2-nitroaniline;propanoic acid?
The canonical SMILES for 2-nitroaniline;propanoic acid is CCC(=O)O.CCC(=O)O.Nc1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-nitroaniline;propanoic acid?
The InChIKey is BOKSFHHVDHNYLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.2C3H6O2/c7-5-3-1-2-4-6(5)8(9)10;2*1-2-3(4)5/h1-4H,7H2;2*2H2,1H3,(H,4,5).
What are the key properties of 2-nitroaniline;propanoic acid?
2-nitroaniline;propanoic acid has a molecular weight of 286.28 g/mol, XLogP of 2.14, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroaniline;propanoic acid is sourced from PubChem (CID 175475481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).