About 2-nitroaniline;dihydrochloride
2-nitroaniline;dihydrochloride (PubChem CID 69408891) has the molecular formula C6H8Cl2N2O2
and a molecular weight of 211.05 g/mol. Its IUPAC name is 2-nitroaniline;dihydrochloride.
Molecular Properties
| Compound Name | 2-nitroaniline;dihydrochloride |
| PubChem CID | 69408891 |
| Molecular Formula | C6H8Cl2N2O2 |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 2-nitroaniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N2O2.2ClH/c7-5-3-1-2-4-6(5)8(9)10;;/h1-4H,7H2;2*1H |
| InChIKey | HGWYZQBMQDIVDB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroaniline;dihydrochloride?
The IUPAC name of 2-nitroaniline;dihydrochloride (CID 69408891) is 2-nitroaniline;dihydrochloride.
What is the SMILES notation for 2-nitroaniline;dihydrochloride?
The canonical SMILES for 2-nitroaniline;dihydrochloride is Cl.Cl.Nc1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-nitroaniline;dihydrochloride?
The InChIKey is HGWYZQBMQDIVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.2ClH/c7-5-3-1-2-4-6(5)8(9)10;;/h1-4H,7H2;2*1H.
What are the key properties of 2-nitroaniline;dihydrochloride?
2-nitroaniline;dihydrochloride has a molecular weight of 211.05 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroaniline;dihydrochloride is sourced from PubChem (CID 69408891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).