C8H7F3N2O4 — CID 141456487
2-nitroaniline;2,2,2-trifluoroacetic acid (PubChem CID 141456487) has the molecular formula C8H7F3N2O4 and a molecular weight of 252.15 g/mol. Its IUPAC name is 2-nitroaniline;2,2,2-trifluoroacetic acid.
| Compound Name | 2-nitroaniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 141456487 |
| Molecular Formula | C8H7F3N2O4 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 2-nitroaniline;2,2,2-trifluoroacetic acid |
| SMILES | Nc1ccccc1[N+](=O)[O-].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H6N2O2.C2HF3O2/c7-5-3-1-2-4-6(5)8(9)10;3-2(4,5)1(6)7/h1-4H,7H2;(H,6,7) |
| InChIKey | JXKCTPRYASMWGR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|