C8H6F3NO4 — CID 161110469
nitrobenzene;2,2,2-trifluoroacetic acid (PubChem CID 161110469) has the molecular formula C8H6F3NO4 and a molecular weight of 237.13 g/mol. Its IUPAC name is nitrobenzene;2,2,2-trifluoroacetic acid.
| Compound Name | nitrobenzene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161110469 |
| Molecular Formula | C8H6F3NO4 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | nitrobenzene;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C2HF3O2/c8-7(9)6-4-2-1-3-5-6;3-2(4,5)1(6)7/h1-5H;(H,6,7) |
| InChIKey | UJPXJYZLOPWPQC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|