About potassium 2-amino-6-nitrobenzoate
potassium 2-amino-6-nitrobenzoate (PubChem CID 71764475) has the molecular formula C7H5KN2O4
and a molecular weight of 220.22 g/mol. Its IUPAC name is potassium 2-amino-6-nitrobenzoate.
Molecular Properties
| Compound Name | potassium 2-amino-6-nitrobenzoate |
| PubChem CID | 71764475 |
| Molecular Formula | C7H5KN2O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | potassium 2-amino-6-nitrobenzoate |
| SMILES | Nc1cccc([N+](=O)[O-])c1C(=O)[O-].[K+] |
| InChI | InChI=1S/C7H6N2O4.K/c8-4-2-1-3-5(9(12)13)6(4)7(10)11;/h1-3H,8H2,(H,10,11);/q;+1/p-1 |
| InChIKey | SUEMFHMNZKXORN-UHFFFAOYSA-M |
| XLogP | -3.46 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-amino-6-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-amino-6-nitrobenzoate?
The IUPAC name of potassium 2-amino-6-nitrobenzoate (CID 71764475) is potassium 2-amino-6-nitrobenzoate.
What is the SMILES notation for potassium 2-amino-6-nitrobenzoate?
The canonical SMILES for potassium 2-amino-6-nitrobenzoate is Nc1cccc([N+](=O)[O-])c1C(=O)[O-].[K+].
What is the InChIKey of potassium 2-amino-6-nitrobenzoate?
The InChIKey is SUEMFHMNZKXORN-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2O4.K/c8-4-2-1-3-5(9(12)13)6(4)7(10)11;/h1-3H,8H2,(H,10,11);/q;+1/p-1.
What are the key properties of potassium 2-amino-6-nitrobenzoate?
potassium 2-amino-6-nitrobenzoate has a molecular weight of 220.22 g/mol, XLogP of -3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-amino-6-nitrobenzoate is sourced from PubChem (CID 71764475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).