About 2-aminobenzoic acid;propanoic acid
2-aminobenzoic acid;propanoic acid (PubChem CID 67067565) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-aminobenzoic acid;propanoic acid.
Molecular Properties
| Compound Name | 2-aminobenzoic acid;propanoic acid |
| PubChem CID | 67067565 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-aminobenzoic acid;propanoic acid |
| SMILES | CCC(=O)O.Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C7H7NO2.C3H6O2/c8-6-4-2-1-3-5(6)7(9)10;1-2-3(4)5/h1-4H,8H2,(H,9,10);2H2,1H3,(H,4,5) |
| InChIKey | YVFPISFGSXRMPM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzoic acid;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzoic acid;propanoic acid?
The IUPAC name of 2-aminobenzoic acid;propanoic acid (CID 67067565) is 2-aminobenzoic acid;propanoic acid.
What is the SMILES notation for 2-aminobenzoic acid;propanoic acid?
The canonical SMILES for 2-aminobenzoic acid;propanoic acid is CCC(=O)O.Nc1ccccc1C(=O)O.
What is the InChIKey of 2-aminobenzoic acid;propanoic acid?
The InChIKey is YVFPISFGSXRMPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C3H6O2/c8-6-4-2-1-3-5(6)7(9)10;1-2-3(4)5/h1-4H,8H2,(H,9,10);2H2,1H3,(H,4,5).
What are the key properties of 2-aminobenzoic acid;propanoic acid?
2-aminobenzoic acid;propanoic acid has a molecular weight of 211.22 g/mol, XLogP of 1.45, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzoic acid;propanoic acid is sourced from PubChem (CID 67067565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).