About 2-aminobenzoic acid;(Z)-hex-3-en-1-ol
2-aminobenzoic acid;(Z)-hex-3-en-1-ol (PubChem CID 170839985) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-aminobenzoic acid;(Z)-hex-3-en-1-ol.
Molecular Properties
| Compound Name | 2-aminobenzoic acid;(Z)-hex-3-en-1-ol |
| PubChem CID | 170839985 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-aminobenzoic acid;(Z)-hex-3-en-1-ol |
| SMILES | CC/C=C\CCO.Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C7H7NO2.C6H12O/c8-6-4-2-1-3-5(6)7(9)10;1-2-3-4-5-6-7/h1-4H,8H2,(H,9,10);3-4,7H,2,5-6H2,1H3/b;4-3- |
| InChIKey | VHTKVIQKFXTZDQ-QGAMPUOQSA-N |
| XLogP | 2.30 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzoic acid;(Z)-hex-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzoic acid;(Z)-hex-3-en-1-ol?
The IUPAC name of 2-aminobenzoic acid;(Z)-hex-3-en-1-ol (CID 170839985) is 2-aminobenzoic acid;(Z)-hex-3-en-1-ol.
What is the SMILES notation for 2-aminobenzoic acid;(Z)-hex-3-en-1-ol?
The canonical SMILES for 2-aminobenzoic acid;(Z)-hex-3-en-1-ol is CC/C=C\CCO.Nc1ccccc1C(=O)O.
What is the InChIKey of 2-aminobenzoic acid;(Z)-hex-3-en-1-ol?
The InChIKey is VHTKVIQKFXTZDQ-QGAMPUOQSA-N. The full InChI is InChI=1S/C7H7NO2.C6H12O/c8-6-4-2-1-3-5(6)7(9)10;1-2-3-4-5-6-7/h1-4H,8H2,(H,9,10);3-4,7H,2,5-6H2,1H3/b;4-3-.
What are the key properties of 2-aminobenzoic acid;(Z)-hex-3-en-1-ol?
2-aminobenzoic acid;(Z)-hex-3-en-1-ol has a molecular weight of 237.30 g/mol, XLogP of 2.30, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzoic acid;(Z)-hex-3-en-1-ol is sourced from PubChem (CID 170839985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).