About 2-aminobenzoic acid;azane
2-aminobenzoic acid;azane (PubChem CID 21425790) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-aminobenzoic acid;azane.
Molecular Properties
| Compound Name | 2-aminobenzoic acid;azane |
| PubChem CID | 21425790 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 2-aminobenzoic acid;azane |
| SMILES | N.N.Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C7H7NO2.2H3N/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4H,8H2,(H,9,10);2*1H3 |
| InChIKey | AKJUOAVTIDJPKY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzoic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzoic acid;azane?
The IUPAC name of 2-aminobenzoic acid;azane (CID 21425790) is 2-aminobenzoic acid;azane.
What is the SMILES notation for 2-aminobenzoic acid;azane?
The canonical SMILES for 2-aminobenzoic acid;azane is N.N.Nc1ccccc1C(=O)O.
What is the InChIKey of 2-aminobenzoic acid;azane?
The InChIKey is AKJUOAVTIDJPKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.2H3N/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4H,8H2,(H,9,10);2*1H3.
What are the key properties of 2-aminobenzoic acid;azane?
2-aminobenzoic acid;azane has a molecular weight of 171.20 g/mol, XLogP of 1.29, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzoic acid;azane is sourced from PubChem (CID 21425790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).