About (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid
(Z)-hex-3-en-1-ol;2-hydroxybenzoic acid (PubChem CID 174957389) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid |
| PubChem CID | 174957389 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid |
| SMILES | CC/C=C\CCO.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C6H12O/c8-6-4-2-1-3-5(6)7(9)10;1-2-3-4-5-6-7/h1-4,8H,(H,9,10);3-4,7H,2,5-6H2,1H3/b;4-3- |
| InChIKey | AQRBJKLDYVDSSQ-QGAMPUOQSA-N |
| XLogP | 2.43 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid?
The IUPAC name of (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid (CID 174957389) is (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid.
What is the SMILES notation for (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid?
The canonical SMILES for (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid is CC/C=C\CCO.O=C(O)c1ccccc1O.
What is the InChIKey of (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid?
The InChIKey is AQRBJKLDYVDSSQ-QGAMPUOQSA-N. The full InChI is InChI=1S/C7H6O3.C6H12O/c8-6-4-2-1-3-5(6)7(9)10;1-2-3-4-5-6-7/h1-4,8H,(H,9,10);3-4,7H,2,5-6H2,1H3/b;4-3-.
What are the key properties of (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid?
(Z)-hex-3-en-1-ol;2-hydroxybenzoic acid has a molecular weight of 238.28 g/mol, XLogP of 2.43, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-hex-3-en-1-ol;2-hydroxybenzoic acid is sourced from PubChem (CID 174957389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).