About chromium;2-hydroxybenzoic acid
chromium;2-hydroxybenzoic acid (PubChem CID 87079476) has the molecular formula C7H6CrO3
and a molecular weight of 190.12 g/mol. Its IUPAC name is chromium;2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | chromium;2-hydroxybenzoic acid |
| PubChem CID | 87079476 |
| Molecular Formula | C7H6CrO3 |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 189.97 |
| IUPAC Name | chromium;2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccccc1O.[Cr] |
| InChI | InChI=1S/C7H6O3.Cr/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10); |
| InChIKey | KYRMFSOATGQQBV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chromium;2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;2-hydroxybenzoic acid?
The IUPAC name of chromium;2-hydroxybenzoic acid (CID 87079476) is chromium;2-hydroxybenzoic acid.
What is the SMILES notation for chromium;2-hydroxybenzoic acid?
The canonical SMILES for chromium;2-hydroxybenzoic acid is O=C(O)c1ccccc1O.[Cr].
What is the InChIKey of chromium;2-hydroxybenzoic acid?
The InChIKey is KYRMFSOATGQQBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.Cr/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);.
What are the key properties of chromium;2-hydroxybenzoic acid?
chromium;2-hydroxybenzoic acid has a molecular weight of 190.12 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;2-hydroxybenzoic acid is sourced from PubChem (CID 87079476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).