chromium;2-hydroxybenzoic acid

C7H6CrO3 — CID 87079476

IUPACchromium;2-hydroxybenzoic acid
SMILESO=C(O)c1ccccc1O.[Cr]
InChIInChI=1S/C7H6O3.Cr/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);
InChIKeyKYRMFSOATGQQBV-UHFFFAOYSA-N
MW190.12 g/mol
LogP1.09
Rot. Bonds1

About chromium;2-hydroxybenzoic acid

chromium;2-hydroxybenzoic acid (PubChem CID 87079476) has the molecular formula C7H6CrO3 and a molecular weight of 190.12 g/mol. Its IUPAC name is chromium;2-hydroxybenzoic acid.

Molecular Properties

Compound Namechromium;2-hydroxybenzoic acid
PubChem CID87079476
Molecular FormulaC7H6CrO3
Molecular Weight190.12 g/mol
Exact Mass189.97
IUPAC Namechromium;2-hydroxybenzoic acid
SMILESO=C(O)c1ccccc1O.[Cr]
InChIInChI=1S/C7H6O3.Cr/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);
InChIKeyKYRMFSOATGQQBV-UHFFFAOYSA-N
XLogP1.09
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.12
LogP ≤ 51.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze chromium;2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chromium;2-hydroxybenzoic acid?
The IUPAC name of chromium;2-hydroxybenzoic acid (CID 87079476) is chromium;2-hydroxybenzoic acid.
What is the SMILES notation for chromium;2-hydroxybenzoic acid?
The canonical SMILES for chromium;2-hydroxybenzoic acid is O=C(O)c1ccccc1O.[Cr].
What is the InChIKey of chromium;2-hydroxybenzoic acid?
The InChIKey is KYRMFSOATGQQBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.Cr/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);.
What are the key properties of chromium;2-hydroxybenzoic acid?
chromium;2-hydroxybenzoic acid has a molecular weight of 190.12 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;2-hydroxybenzoic acid is sourced from PubChem (CID 87079476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).