About strontium;hydride;2-hydroxybenzoic acid
strontium;hydride;2-hydroxybenzoic acid (PubChem CID 172999910) has the molecular formula C7H8O3Sr
and a molecular weight of 227.76 g/mol. Its IUPAC name is strontium;hydride;2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | strontium;hydride;2-hydroxybenzoic acid |
| PubChem CID | 172999910 |
| Molecular Formula | C7H8O3Sr |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.95 |
| IUPAC Name | strontium;hydride;2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccccc1O.[H-].[H-].[Sr+2] |
| InChI | InChI=1S/C7H6O3.Sr.2H/c8-6-4-2-1-3-5(6)7(9)10;;;/h1-4,8H,(H,9,10);;;/q;+2;2*-1 |
| InChIKey | JGGXBVXGDJBPDM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze strontium;hydride;2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;hydride;2-hydroxybenzoic acid?
The IUPAC name of strontium;hydride;2-hydroxybenzoic acid (CID 172999910) is strontium;hydride;2-hydroxybenzoic acid.
What is the SMILES notation for strontium;hydride;2-hydroxybenzoic acid?
The canonical SMILES for strontium;hydride;2-hydroxybenzoic acid is O=C(O)c1ccccc1O.[H-].[H-].[Sr+2].
What is the InChIKey of strontium;hydride;2-hydroxybenzoic acid?
The InChIKey is JGGXBVXGDJBPDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.Sr.2H/c8-6-4-2-1-3-5(6)7(9)10;;;/h1-4,8H,(H,9,10);;;/q;+2;2*-1.
What are the key properties of strontium;hydride;2-hydroxybenzoic acid?
strontium;hydride;2-hydroxybenzoic acid has a molecular weight of 227.76 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;hydride;2-hydroxybenzoic acid is sourced from PubChem (CID 172999910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).