About 2-hydroxybenzoic acid;silver
2-hydroxybenzoic acid;silver (PubChem CID 87326670) has the molecular formula C7H6Ag2O3
and a molecular weight of 353.86 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;silver.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;silver |
| PubChem CID | 87326670 |
| Molecular Formula | C7H6Ag2O3 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 351.84 |
| IUPAC Name | 2-hydroxybenzoic acid;silver |
| SMILES | O=C(O)c1ccccc1O.[Ag].[Ag] |
| InChI | InChI=1S/C7H6O3.2Ag/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4,8H,(H,9,10);; |
| InChIKey | FVTPPNWXNLDAIA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxybenzoic acid;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;silver?
The IUPAC name of 2-hydroxybenzoic acid;silver (CID 87326670) is 2-hydroxybenzoic acid;silver.
What is the SMILES notation for 2-hydroxybenzoic acid;silver?
The canonical SMILES for 2-hydroxybenzoic acid;silver is O=C(O)c1ccccc1O.[Ag].[Ag].
What is the InChIKey of 2-hydroxybenzoic acid;silver?
The InChIKey is FVTPPNWXNLDAIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.2Ag/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4,8H,(H,9,10);;.
What are the key properties of 2-hydroxybenzoic acid;silver?
2-hydroxybenzoic acid;silver has a molecular weight of 353.86 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;silver is sourced from PubChem (CID 87326670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).