About acetonitrile;1,2-dinitrobenzene
acetonitrile;1,2-dinitrobenzene (PubChem CID 174895848) has the molecular formula C8H7N3O4
and a molecular weight of 209.16 g/mol. Its IUPAC name is acetonitrile;1,2-dinitrobenzene.
Molecular Properties
| Compound Name | acetonitrile;1,2-dinitrobenzene |
| PubChem CID | 174895848 |
| Molecular Formula | C8H7N3O4 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | acetonitrile;1,2-dinitrobenzene |
| SMILES | CC#N.O=[N+]([O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4N2O4.C2H3N/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-2-3/h1-4H;1H3 |
| InChIKey | NRQFZJNMIQUDGM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;1,2-dinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;1,2-dinitrobenzene?
The IUPAC name of acetonitrile;1,2-dinitrobenzene (CID 174895848) is acetonitrile;1,2-dinitrobenzene.
What is the SMILES notation for acetonitrile;1,2-dinitrobenzene?
The canonical SMILES for acetonitrile;1,2-dinitrobenzene is CC#N.O=[N+]([O-])c1ccccc1[N+](=O)[O-].
What is the InChIKey of acetonitrile;1,2-dinitrobenzene?
The InChIKey is NRQFZJNMIQUDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O4.C2H3N/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-2-3/h1-4H;1H3.
What are the key properties of acetonitrile;1,2-dinitrobenzene?
acetonitrile;1,2-dinitrobenzene has a molecular weight of 209.16 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;1,2-dinitrobenzene is sourced from PubChem (CID 174895848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).