About methanol;2-nitrophenol
methanol;2-nitrophenol (PubChem CID 157303764) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is methanol;2-nitrophenol.
Molecular Properties
| Compound Name | methanol;2-nitrophenol |
| PubChem CID | 157303764 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | methanol;2-nitrophenol |
| SMILES | CO.O=[N+]([O-])c1ccccc1O |
| InChI | InChI=1S/C6H5NO3.CH4O/c8-6-4-2-1-3-5(6)7(9)10;1-2/h1-4,8H;2H,1H3 |
| InChIKey | BCFASYXIBZTTGS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-nitrophenol?
The IUPAC name of methanol;2-nitrophenol (CID 157303764) is methanol;2-nitrophenol.
What is the SMILES notation for methanol;2-nitrophenol?
The canonical SMILES for methanol;2-nitrophenol is CO.O=[N+]([O-])c1ccccc1O.
What is the InChIKey of methanol;2-nitrophenol?
The InChIKey is BCFASYXIBZTTGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3.CH4O/c8-6-4-2-1-3-5(6)7(9)10;1-2/h1-4,8H;2H,1H3.
What are the key properties of methanol;2-nitrophenol?
methanol;2-nitrophenol has a molecular weight of 171.15 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-nitrophenol is sourced from PubChem (CID 157303764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).