About methanol;(2-nitrophenyl)methanol
methanol;(2-nitrophenyl)methanol (PubChem CID 70046885) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is methanol;(2-nitrophenyl)methanol.
Molecular Properties
| Compound Name | methanol;(2-nitrophenyl)methanol |
| PubChem CID | 70046885 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | methanol;(2-nitrophenyl)methanol |
| SMILES | CO.O=[N+]([O-])c1ccccc1CO |
| InChI | InChI=1S/C7H7NO3.CH4O/c9-5-6-3-1-2-4-7(6)8(10)11;1-2/h1-4,9H,5H2;2H,1H3 |
| InChIKey | VHMPCWUVPLOJPZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanol;(2-nitrophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;(2-nitrophenyl)methanol?
The IUPAC name of methanol;(2-nitrophenyl)methanol (CID 70046885) is methanol;(2-nitrophenyl)methanol.
What is the SMILES notation for methanol;(2-nitrophenyl)methanol?
The canonical SMILES for methanol;(2-nitrophenyl)methanol is CO.O=[N+]([O-])c1ccccc1CO.
What is the InChIKey of methanol;(2-nitrophenyl)methanol?
The InChIKey is VHMPCWUVPLOJPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.CH4O/c9-5-6-3-1-2-4-7(6)8(10)11;1-2/h1-4,9H,5H2;2H,1H3.
What are the key properties of methanol;(2-nitrophenyl)methanol?
methanol;(2-nitrophenyl)methanol has a molecular weight of 185.18 g/mol, XLogP of 0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;(2-nitrophenyl)methanol is sourced from PubChem (CID 70046885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).