About [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol
[5-(hydroxymethyl)-2,4-dinitrophenyl]methanol (PubChem CID 3316930) has the molecular formula C8H8N2O6
and a molecular weight of 228.16 g/mol. Its IUPAC name is [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol |
| PubChem CID | 3316930 |
| Molecular Formula | C8H8N2O6 |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(CO)cc1CO |
| InChI | InChI=1S/C8H8N2O6/c11-3-5-1-6(4-12)8(10(15)16)2-7(5)9(13)14/h1-2,11-12H,3-4H2 |
| InChIKey | WMIDDVGHYRKJJZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol?
The IUPAC name of [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol (CID 3316930) is [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol is O=[N+]([O-])c1cc([N+](=O)[O-])c(CO)cc1CO.
What is the InChIKey of [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol?
The InChIKey is WMIDDVGHYRKJJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O6/c11-3-5-1-6(4-12)8(10(15)16)2-7(5)9(13)14/h1-2,11-12H,3-4H2.
What are the key properties of [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol?
[5-(hydroxymethyl)-2,4-dinitrophenyl]methanol has a molecular weight of 228.16 g/mol, XLogP of 0.49, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-2,4-dinitrophenyl]methanol is sourced from PubChem (CID 3316930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).