C9H11NO5 — CID 67840486
methane;(6-nitro-1,3-benzodioxol-5-yl)methanol (PubChem CID 67840486) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is methane;(6-nitro-1,3-benzodioxol-5-yl)methanol.
| Compound Name | methane;(6-nitro-1,3-benzodioxol-5-yl)methanol |
|---|---|
| PubChem CID | 67840486 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | methane;(6-nitro-1,3-benzodioxol-5-yl)methanol |
| SMILES | C.O=[N+]([O-])c1cc2c(cc1CO)OCO2 |
| InChI | InChI=1S/C8H7NO5.CH4/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12;/h1-2,10H,3-4H2;1H4 |
| InChIKey | QOVCYOARKLBKCY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|