C10H9NO7 — CID 46174282
2-hydroxy-3-(6-nitro-1,3-benzodioxol-5-yl)propanoic acid (PubChem CID 46174282) has the molecular formula C10H9NO7 and a molecular weight of 255.18 g/mol. Its IUPAC name is 2-hydroxy-3-(6-nitro-1,3-benzodioxol-5-yl)propanoic acid.
| Compound Name | 2-hydroxy-3-(6-nitro-1,3-benzodioxol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 46174282 |
| Molecular Formula | C10H9NO7 |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 2-hydroxy-3-(6-nitro-1,3-benzodioxol-5-yl)propanoic acid |
| SMILES | O=C(O)C(O)Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C10H9NO7/c12-7(10(13)14)1-5-2-8-9(18-4-17-8)3-6(5)11(15)16/h2-3,7,12H,1,4H2,(H,13,14) |
| InChIKey | NBIYUKDOCYVGLU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|