C12H11NO6 — CID 25170272
methyl 2-[(6-nitro-1,3-benzodioxol-5-yl)methyl]prop-2-enoate (PubChem CID 25170272) has the molecular formula C12H11NO6 and a molecular weight of 265.22 g/mol. Its IUPAC name is methyl 2-[(6-nitro-1,3-benzodioxol-5-yl)methyl]prop-2-enoate.
| Compound Name | methyl 2-[(6-nitro-1,3-benzodioxol-5-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 25170272 |
| Molecular Formula | C12H11NO6 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | methyl 2-[(6-nitro-1,3-benzodioxol-5-yl)methyl]prop-2-enoate |
| SMILES | C=C(Cc1cc2c(cc1[N+](=O)[O-])OCO2)C(=O)OC |
| InChI | InChI=1S/C12H11NO6/c1-7(12(14)17-2)3-8-4-10-11(19-6-18-10)5-9(8)13(15)16/h4-5H,1,3,6H2,2H3 |
| InChIKey | FKXAYFXTMLHFQC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|