C16H16N2O10 — CID 16751769
1-O-ethyl 5-O-methyl (4E)-2-nitro-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]pentanedioate (PubChem CID 16751769) has the molecular formula C16H16N2O10 and a molecular weight of 396.31 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (4E)-2-nitro-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]pentanedioate.
| Compound Name | 1-O-ethyl 5-O-methyl (4E)-2-nitro-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]pentanedioate |
|---|---|
| PubChem CID | 16751769 |
| Molecular Formula | C16H16N2O10 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (4E)-2-nitro-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]pentanedioate |
| SMILES | CCOC(=O)C(C/C(=C\c1cc2c(cc1[N+](=O)[O-])OCO2)C(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N2O10/c1-3-26-16(20)12(18(23)24)5-10(15(19)25-2)4-9-6-13-14(28-8-27-13)7-11(9)17(21)22/h4,6-7,12H,3,5,8H2,1-2H3/b10-4+ |
| InChIKey | USCQGAIPCTYKGU-ONNFQVAWSA-N |
| XLogP | 1.48 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|